BIOPEP-UWM: Report
| ID | 3495 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Inhibitor of platelet aggregation | |||
| Number of residues | 10 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1184.3467 | Monoisotopic mass | 1183.4887 | |
| EC50 : | 132.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cierniewski C. S., Byzova T., Papierak M., Haas T. A., Niewiarowska J., Zhang L., Cieslak M., Plow E. F. | |
| Title | |
| Peptide ligands can bind to distinct sites in integrin alphaIIb-beta3 and elicit different functional responses. J Biol. Chem., 274, 16923-16932, 1999 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)N4[C@@H](CCC4)C(=O)N[C@@H](CS)C(=O)O InChI=1S/C51H73N15O14S2/c52-16-4-3-8-31(53)43(72)63-34(19-27-12-14-29(67)15-13-27)45(74)59-24-41(69)61-37(25-81)47(76)62-33(10-5-17-56-51(54)55)44(73)58-23-40(68)60-35(21-42(70)71)46(75)64-36(20-28-22-57-32-9-2-1-7-30(28)32)49(78)66-18-6-11-39(66)48(77)65-38(26-82)50(79)80/h1-2,7,9,12-15,22,31,33-39,57,67,81-82H,3-6,8,10-11,16-21,23-26,52-53H2,(H,58,73)(H,59,74)(H,60,68)(H,61,69)(H,62,76)(H,63,72)(H,64,75)(H,65,77)(H,70,71)(H,79,80)(H4,54,55,56)/t31-,33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey=XGXXUCMEOYZTNJ-BUGSXBMSSA-N |
| Database reference: |
| PepBank: peptide KYGCRGDWPC |