BIOPEP-UWM: Report
| ID | 3504 |
| Name | ACE inhibitor (bCN fr.59-64) |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 678.7733 | Monoisotopic mass | 678.3366 | |
| EC50 : | 221.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Abubakar A., Saito T., Kitazawa H., Kawai Y., Itoh T. | |
| Title | |
| Structural analysis of new antihypertensive peptides derived from cheese whey protein by proteinase K digestion. J.Dairy Sci., 81(12) 3131-3138(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(O)=O InChI=1S/C35H46N6O8/c1-21(2)30(36)33(47)39-26(19-23-12-14-24(42)15-13-23)35(49)41-17-7-11-28(41)32(46)38-25(18-22-8-4-3-5-9-22)34(48)40-16-6-10-27(40)31(45)37-20-29(43)44/h3-5,8-9,12-15,21,25-28,30,42H,6-7,10-11,16-20,36H2,1-2H3,(H,37,45)(H,38,46)(H,39,47)(H,43,44)/t25-,26-,27-,28-,30-/m0/s1 InChIKey=XGHISKWRPVAFOO-KGEMVMTLSA-N |
| Database reference: |