BIOPEP-UWM: Report
ID | 3514 |
Name | ACE inhibitor (a-La 105-110) |
sequence |
Function: | |||
Number of residues | 6 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 651.7958 | Monoisotopic mass | 651.4056 | |
EC50 : | 621.00 µM |
Bibliographic data: | |
Authors | |
Pihlanto-Leppala A., Rokka T., Korhonen H. | |
Title | |
Angiotensin I converting enzyme inhibitory peptides derived from bovine milk proteins. Int. Dairy Journal 8, 325-331(1998) | |
Year | Source |
1998 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C30H53N9O7/c1-16(2)11-21(32)27(42)35-18(5)25(40)38-23(13-20-14-33-15-34-20)29(44)37-22(9-7-8-10-31)28(43)36-19(6)26(41)39-24(30(45)46)12-17(3)4/h14-19,21-24H,7-13,31-32H2,1-6H3,(H,33,34)(H,35,42)(H,36,43)(H,37,44)(H,38,40)(H,39,41)(H,45,46)/t18-,19-,21-,22-,23-,24-/m0/s1 InChIKey=NLCNCRBTXJLEIY-HEZDJTGRSA-N |
Database reference: |