BIOPEP-UWM: Report
| ID | 3514 |
| Name | ACE inhibitor (a-La 105-110) |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 651.7958 | Monoisotopic mass | 651.4056 | |
| IC50 : | 621.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A., Rokka T., Korhonen H. | |
| Title | |
| Angiotensin I converting enzyme inhibitory peptides derived from bovine milk proteins. Int. Dairy Journal 8, 325-331(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C30H53N9O7/c1-16(2)11-21(32)27(42)35-18(5)25(40)38-23(13-20-14-33-15-34-20)29(44)37-22(9-7-8-10-31)28(43)36-19(6)26(41)39-24(30(45)46)12-17(3)4/h14-19,21-24H,7-13,31-32H2,1-6H3,(H,33,34)(H,35,42)(H,36,43)(H,37,44)(H,38,40)(H,39,41)(H,45,46)/t18-,19-,21-,22-,23-,24-/m0/s1 InChIKey=NLCNCRBTXJLEIY-HEZDJTGRSA-N |
| Database reference: |