BIOPEP-UWM: Report
| ID | 3526 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 561.6719 | Monoisotopic mass | 561.3265 | |
| EC50 : | 18.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Kaneko T., Tanaka H. | |
| Title | |
| Angotensin I-converting enzyme inhibitory activities of synthetic peptides related to the tandem repeated sequence of a maize endosperm protein.Agric.Biol.Chem.53(4),1077-1081(1989) | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C27H43N7O6/c1-15(2)11-19(25(37)33-9-5-7-20(33)26(38)34-10-6-8-21(34)27(39)40)32-23(35)18(12-17-13-29-14-30-17)31-24(36)22(28)16(3)4/h13-16,18-22H,5-12,28H2,1-4H3,(H,29,30)(H,31,36)(H,32,35)(H,39,40)/t18-,19-,20-,21-,22-/m0/s1 InChIKey=IUHQCDZLRCFCJM-YFNVTMOMSA-N |
| Database reference: |