BIOPEP-UWM: Report
| ID | 3527 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 658.7868 | Monoisotopic mass | 658.3791 | |
| IC50 : | 200.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Kaneko T., Tanaka H. | |
| Title | |
| Angotensin I-converting enzyme inhibitory activities of synthetic peptides related to the tandem repeated sequence of a maize endosperm protein.Agric.Biol.Chem.53(4),1077-1081(1989) | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C32H50N8O7/c1-18(2)14-22(37-27(41)21(15-20-16-34-17-35-20)36-28(42)26(33)19(3)4)29(43)38-11-5-8-23(38)30(44)39-12-6-9-24(39)31(45)40-13-7-10-25(40)32(46)47/h16-19,21-26H,5-15,33H2,1-4H3,(H,34,35)(H,36,42)(H,37,41)(H,46,47)/t21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=VRBRSQUJTJSJCL-FRSCJGFNSA-N |
| Database reference: |