BIOPEP-UWM: Report
| ID | 3534 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 597.6611 | Monoisotopic mass | 597.2902 | |
| EC50 : | 17.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito Y., Wanezaki K., Kawato A., Imayasu S. | |
| Title | |
| Structure and activity of angiotensin I converting enzyme inhibitory peptides from sake and sake lees. Biosci.Biotech.Biochem.58(10),1767-1771(1994) | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C29H39N7O7/c30-21(15-17-5-9-19(37)10-6-17)27(41)36-14-2-4-24(36)26(40)34-22(3-1-13-33-29(31)32)25(39)35-23(28(42)43)16-18-7-11-20(38)12-8-18/h5-12,21-24,37-38H,1-4,13-16,30H2,(H,34,40)(H,35,39)(H,42,43)(H4,31,32,33)/t21-,22-,23-,24-/m0/s1 InChIKey=BQRCCVQRJWIGGD-ZJZGAYNASA-N |
| Database reference: |