BIOPEP-UWM: Report
ID | 3545 |
Name | ACE inhibitor |
sequence |
Function: | |||
Number of residues | 5 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 535.6347 | Monoisotopic mass | 535.3109 | |
EC50 : | 4.50 µM |
Bibliographic data: | |
Authors | |
Maruyama S., Miyoshi S., Kaneko T., Tanaka H. | |
Title | |
Angotensin I-converting enzyme inhibitory activities of synthetic peptides related to the tandem repeated sequence of a maize endosperm protein.Agric.Biol.Chem.53(4),1077-1081(1989) | |
Year | Source |
1989 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]([H])(CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C25H41N7O6/c1-13(2)9-17(21(33)29-15(5)24(36)32-8-6-7-19(32)25(37)38)30-22(34)18(10-16-11-27-12-28-16)31-23(35)20(26)14(3)4/h11-15,17-20H,6-10,26H2,1-5H3,(H,27,28)(H,29,33)(H,30,34)(H,31,35)(H,37,38)/t15-,17-,18-,19-,20-/m0/s1 InChIKey=LTHJWGJDQGQTFZ-JBDAPHQKSA-N |
Database reference: |