BIOPEP-UWM: Report
| ID | 3560 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1191.3611 | Monoisotopic mass | 1190.5961 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CS)C(=O)N[C@]([H])(C(O)=O)[C@@]([H])(C)O InChI=1S/C50H82N18O14S/c1-25(52)47(80)68-19-9-15-37(68)46(79)62-32(14-8-18-58-50(55)56)39(72)60-30(12-5-6-16-51)41(74)64-35(23-70)44(77)65-34(22-69)43(76)61-31(13-7-17-57-49(53)54)40(73)63-33(20-27-21-59-29-11-4-3-10-28(27)29)42(75)66-36(24-83)45(78)67-38(26(2)71)48(81)82/h3-4,10-11,21,25-26,30-38,59,69-71,83H,5-9,12-20,22-24,51-52H2,1-2H3,(H,60,72)(H,61,76)(H,62,79)(H,63,73)(H,64,74)(H,65,77)(H,66,75)(H,67,78)(H,81,82)(H4,53,54,57)(H4,55,56,58)/t25-,26+,30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=SWHDKICERYYPOM-LOPWDSDJSA-N |
| Database reference: |