BIOPEP-UWM: Report
| ID | 3569 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 982.1286 | Monoisotopic mass | 981.5477 | |
| EC50 : | 570.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohmura M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of angiotensin-converting enzyme by synthetic peptide fragments of various beta-caseins. Agric.Biol.Chem. 54(4),1101-1102(1990) | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(N)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@]([H])(C(=O)N1CCC[C@@]1([H])C(O)=O)[C@@]([H])(C)CC InChI=1S/C44H75N11O14/c1-6-23(3)34(47)41(65)50-27(15-17-32(46)57)38(62)52-29(22-56)39(63)51-28(16-18-33(58)59)42(66)54-20-10-13-30(54)40(64)49-26(12-8-9-19-45)37(61)48-25(5)36(60)53-35(24(4)7-2)43(67)55-21-11-14-31(55)44(68)69/h23-31,34-35,56H,6-22,45,47H2,1-5H3,(H2,46,57)(H,48,61)(H,49,64)(H,50,65)(H,51,63)(H,52,62)(H,53,60)(H,58,59)(H,68,69)/t23-,24-,25-,26-,27-,28-,29-,30-,31-,34-,35-/m0/s1 InChIKey=NVQHMSQFSXSVIN-KKYHKPCUSA-N |
| Database reference: |