BIOPEP-UWM: Report
ID | 3573 |
Name |
sequence |
Function: | |||
Number of residues | 3 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 333.3813 | Monoisotopic mass | 333.1683 | |
EC50 : | 610.00 µM |
Bibliographic data: | |
Authors | |
Kohmura M., Nio N., Ariyoshi Y. | |
Title | |
Inhibition of angiotensin-converting enzyme by synthetic peptide fragments of various beta-caseins. Agric.Biol.Chem. 54(4),1101-1102(1990) | |
Year | Source |
1990 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C17H23N3O4/c1-11(18)15(21)19-13(10-12-6-3-2-4-7-12)16(22)20-9-5-8-14(20)17(23)24/h2-4,6-7,11,13-14H,5,8-10,18H2,1H3,(H,19,21)(H,23,24)/t11-,13-,14-/m0/s1 InChIKey=OSRZOHXQCUFIQG-UBHSHLNASA-N |
Database reference: |