BIOPEP-UWM: Report
| ID | 3584 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 661.7494 | Monoisotopic mass | 661.3860 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kluczyk A., Siemion I. Z., Słoń-Usakiewicz J. J., Wieczorek Z. | |
| Title | |
| Immunomodulatory activity of oligopeptides related to interleukin 1 receptor antagonist sequence. Arch. Immunolog.Therap.Experim. 45,427-433(1997) | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCCN)(NC(=O)[C@]([H])(CO)NC(=O)[C@]([H])(CO)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)CN)C(O)=O InChI=1S/C26H51N11O9/c27-9-3-1-6-16(34-21(41)15(33-20(40)12-29)8-5-11-32-26(30)31)22(42)36-19(14-39)24(44)37-18(13-38)23(43)35-17(25(45)46)7-2-4-10-28/h15-19,38-39H,1-14,27-29H2,(H,33,40)(H,34,41)(H,35,43)(H,36,42)(H,37,44)(H,45,46)(H4,30,31,32)/t15-,16-,17-,18-,19-/m0/s1 InChIKey=LQJUGDLKXQZPAP-VMXHOPILSA-N |
| Database reference: |