BIOPEP-UWM: Report
| ID | 3586 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1146.3635 | Monoisotopic mass | 1145.6110 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(C)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCSC)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(C)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C50H83N17O12S/c1-27(41(70)59-26-40(69)60-29(3)49(78)79)61-44(73)34(14-7-9-20-51)65-46(75)35(15-8-10-21-52)66-48(77)38(19-23-80-4)67-47(76)36(16-11-22-57-50(55)56)63-42(71)28(2)62-45(74)37(17-18-39(54)68)64-43(72)32(53)24-30-25-58-33-13-6-5-12-31(30)33/h5-6,12-13,25,27-29,32,34-38,58H,7-11,14-24,26,51-53H2,1-4H3,(H2,54,68)(H,59,70)(H,60,69)(H,61,73)(H,62,74)(H,63,71)(H,64,72)(H,65,75)(H,66,77)(H,67,76)(H,78,79)(H4,55,56,57)/t27-,28-,29-,32-,34-,35-,36-,37-,38-/m0/s1 InChIKey=QURWOMDPNXECOC-POUOSHGOSA-N |
| Database reference: |