BIOPEP-UWM: Report
| ID | 3587 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 614.7361 | Monoisotopic mass | 614.3320 | |
| EC50 : | 0.02 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dooley C.T., Kaplan R.A., Chung N.N., Schiller P.W., Bidlack J.M., Houghten R.A. | |
| Title | |
| Six highly active mu-selective opioid peptides identified from two synthetic combinatorial libraries. Peptide Research, 8, 3, 124-137(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCCN)(NC(=O)[C@]1([H])CCCN1C(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(N)=O InChI=1S/C33H42N8O4/c34-14-6-5-12-27(30(36)42)39-32(44)29-13-7-15-41(29)33(45)28(17-21-19-38-26-11-4-2-9-23(21)26)40-31(43)24(35)16-20-18-37-25-10-3-1-8-22(20)25/h1-4,8-11,18-19,24,27-29,37-38H,5-7,12-17,34-35H2,(H2,36,42)(H,39,44)(H,40,43)/t24-,27-,28-,29-/m0/s1 InChIKey=VAYOBULKNNBOOC-JSRHHAARSA-N Originally EC50 was expressed in [nM], in BIOPEP-UWM EC50 value was transformed to [uM]. |
| Database reference: |