BIOPEP-UWM: Report
| ID | 3593 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1229.4292 | Monoisotopic mass | 1228.6810 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCCCN)NC(=O)CNC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C58H88N18O12/c1-32(2)25-45(52(82)69-30-48(78)70-33(3)57(87)88)75-54(84)43(18-9-11-23-60)74-53(83)42(17-8-10-22-59)71-49(79)31-68-51(81)41(19-12-24-65-58(63)64)73-56(86)46(27-35-29-67-40-16-7-5-14-37(35)40)76-55(85)44(20-21-47(62)77)72-50(80)38(61)26-34-28-66-39-15-6-4-13-36(34)39/h4-7,13-16,28-29,32-33,38,41-46,66-67H,8-12,17-27,30-31,59-61H2,1-3H3,(H2,62,77)(H,68,81)(H,69,82)(H,70,78)(H,71,79)(H,72,80)(H,73,86)(H,74,83)(H,75,84)(H,76,85)(H,87,88)(H4,63,64,65)/t33-,38-,41-,42-,43-,44-,45-,46-/m0/s1 InChIKey=AYFDEZPFNZLVIP-CRPWATRLSA-N |
| Database reference: |