BIOPEP-UWM: Report
| ID | 3598 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1210.4957 | Monoisotopic mass | 1209.5552 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(CS)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCSC)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(CS)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C50H83N17O12S3/c1-27(49(78)79)60-40(69)24-59-42(71)37(25-80)66-45(74)33(13-6-8-19-52)62-43(72)32(12-5-7-18-51)63-47(76)36(17-21-82-2)65-44(73)34(14-9-20-57-50(55)56)64-48(77)38(26-81)67-46(75)35(15-16-39(54)68)61-41(70)30(53)22-28-23-58-31-11-4-3-10-29(28)31/h3-4,10-11,23,27,30,32-38,58,80-81H,5-9,12-22,24-26,51-53H2,1-2H3,(H2,54,68)(H,59,71)(H,60,69)(H,61,70)(H,62,72)(H,63,76)(H,64,77)(H,65,73)(H,66,74)(H,67,75)(H,78,79)(H4,55,56,57)/t27-,30-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=HBZGMRMKDQAIME-ABDQLQCASA-N |
| Database reference: |