BIOPEP-UWM: Report
| ID | 3601 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1246.4807 | Monoisotopic mass | 1245.6422 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(C)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCSC)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C58H87N17O12S/c1-31(2)25-45(51(80)67-30-48(77)68-33(4)57(86)87)74-49(78)32(3)69-52(81)41(17-10-11-22-59)71-55(84)44(21-24-88-5)73-53(82)42(18-12-23-64-58(62)63)72-56(85)46(27-35-29-66-40-16-9-7-14-37(35)40)75-54(83)43(19-20-47(61)76)70-50(79)38(60)26-34-28-65-39-15-8-6-13-36(34)39/h6-9,13-16,28-29,31-33,38,41-46,65-66H,10-12,17-27,30,59-60H2,1-5H3,(H2,61,76)(H,67,80)(H,68,77)(H,69,81)(H,70,79)(H,71,84)(H,72,85)(H,73,82)(H,74,78)(H,75,83)(H,86,87)(H4,62,63,64)/t32-,33-,38-,41-,42-,43-,44-,45-,46-/m0/s1 InChIKey=DWNIYKRPJQMZPJ-BEYSFOGESA-N |
| Database reference: |