BIOPEP-UWM: Report
| ID | 3603 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1149.3641 | Monoisotopic mass | 1148.6106 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(NC(=O)[C@]([H])(CO)NC(=O)[C@]1([H])CCCN1)[C@@]([H])(C)CC)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C50H84N16O13S/c1-7-26(4)37(65-43(73)34(23-67)62-40(70)30-16-11-19-55-30)46(76)66-38(28(6)68)47(77)63-35(24-80)44(74)64-36(25(2)3)45(75)60-32(18-13-21-57-50(53)54)42(72)59-31(17-12-20-56-49(51)52)41(71)58-27(5)39(69)61-33(48(78)79)22-29-14-9-8-10-15-29/h8-10,14-15,25-28,30-38,55,67-68,80H,7,11-13,16-24H2,1-6H3,(H,58,71)(H,59,72)(H,60,75)(H,61,69)(H,62,70)(H,63,77)(H,64,74)(H,65,73)(H,66,76)(H,78,79)(H4,51,52,56)(H4,53,54,57)/t26-,27-,28+,30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=MQRVHYDEBYZATL-DAFFHULHSA-N . |
| Database reference: |