BIOPEP-UWM: Report
| ID | 3605 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1145.3325 | Monoisotopic mass | 1144.5794 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CS)C(=O)N[C@]([H])(C(O)=O)[C@@]([H])(C)O InChI=1S/C50H80N16O13S/c1-24(2)38(47(76)58-26(4)40(69)61-33(20-28-22-57-30-13-7-6-12-29(28)30)43(72)63-35(23-80)45(74)65-39(27(5)67)49(78)79)64-44(73)34(21-37(53)68)62-42(71)31(14-8-9-17-51)59-41(70)32(15-10-18-56-50(54)55)60-46(75)36-16-11-19-66(36)48(77)25(3)52/h6-7,12-13,22,24-27,31-36,38-39,57,67,80H,8-11,14-21,23,51-52H2,1-5H3,(H2,53,68)(H,58,76)(H,59,70)(H,60,75)(H,61,69)(H,62,71)(H,63,72)(H,64,73)(H,65,74)(H,78,79)(H4,54,55,56)/t25-,26-,27+,31-,32-,33-,34-,35-,36-,38-,39-/m0/s1 InChIKey=DZCSBOUVVUWRNZ-XCJGASIOSA-N |
| Database reference: |