BIOPEP-UWM: Report
| ID | 3606 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 727.8471 | Monoisotopic mass | 727.3682 | |
| EC50 : | 0.05 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dooley C.T., Kaplan R.A., Chung N.N., Schiller P.W., Bidlack J.M., Houghten R.A. | |
| Title | |
| Six highly active mu-selective opioid peptides identified from two synthetic combinatorial libraries. Peptide Research, 8, 3, 124-137(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(N)=O InChI=1S/C39H49N7O7/c1-24(2)34(35(41)49)45-37(51)31(22-26-12-7-4-8-13-26)43-33(48)23-42-36(50)30(21-25-10-5-3-6-11-25)44-38(52)32-14-9-19-46(32)39(53)29(40)20-27-15-17-28(47)18-16-27/h3-8,10-13,15-18,24,29-32,34,47H,9,14,19-23,40H2,1-2H3,(H2,41,49)(H,42,50)(H,43,48)(H,44,52)(H,45,51)/t29-,30-,31-,32-,34-/m0/s1 InChIKey=SBAHFVRNZSRMLG-JOBLXHLTSA-N Originally EC50 was expressed in [nM], in BIOPEP-UWM EC50 value was transformed to [uM]. |
| Database reference: |