BIOPEP-UWM: Report
| ID | 3607 |
| Name | heparin-binding peptide |
| sequence |
| Function: | |||
| Number of residues | 10 |
Activity code | hep_bin |
| Activity : | heparin binding |
|||
| Chemical mass | 1243.4557 | Monoisotopic mass | 1242.6966 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shimazaki K., Tazume T., Uji K., Tanaka M., Kumura H., Mikawa K., Shimo-Oka T. | |
| Title | |
| Properties of a heparin-binding peptide derived from bovine lactoferrin. J.Dairy Sci. 81, 2841-2849(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]([H])(C)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C59H90N18O12/c1-32(2)26-46(52(82)69-31-49(79)70-34(4)58(88)89)76-55(85)43(19-10-12-24-61)74-54(84)42(18-9-11-23-60)72-50(80)33(3)71-53(83)44(20-13-25-66-59(64)65)75-57(87)47(28-36-30-68-41-17-8-6-15-38(36)41)77-56(86)45(21-22-48(63)78)73-51(81)39(62)27-35-29-67-40-16-7-5-14-37(35)40/h5-8,14-17,29-30,32-34,39,42-47,67-68H,9-13,18-28,31,60-62H2,1-4H3,(H2,63,78)(H,69,82)(H,70,79)(H,71,83)(H,72,80)(H,73,81)(H,74,84)(H,75,87)(H,76,85)(H,77,86)(H,88,89)(H4,64,65,66)/t33-,34-,39-,42-,43-,44-,45-,46-,47-/m0/s1 InChIKey=JJKBEMOCHHBICF-PEVYBJPSSA-N |
| Database reference: |