BIOPEP-UWM: Report
ID | 3613 |
Name |
sequence |
Function: | |||
Number of residues | 5 |
Activity code | is |
Activity : | immunostimulating |
|||
Chemical mass | 587.6678 | Monoisotopic mass | 587.3381 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
Title | |
The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
Year | Source |
1995 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)NCC(O)=O InChI=1S/C24H45N9O8/c1-13(2)10-16(23(41)33-17(11-18(34)35)21(39)30-12-19(36)37)32-22(40)15(7-3-4-8-25)31-20(38)14(26)6-5-9-29-24(27)28/h13-17H,3-12,25-26H2,1-2H3,(H,30,39)(H,31,38)(H,32,40)(H,33,41)(H,34,35)(H,36,37)(H4,27,28,29)/t14-,15-,16-,17-/m0/s1 InChIKey=UYUWENNUUZEDIP-QAETUUGQSA-N |
Database reference: |