BIOPEP-UWM: Report
| ID | 3614 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | is |
| Activity : | immunostimulating |
|||
| Chemical mass | 599.7214 | Monoisotopic mass | 599.3744 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(N)CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C26H49N9O7/c1-14(2)19(25(41)42)33-22(38)17(9-4-5-11-27)32-23(39)18-10-7-13-35(18)24(40)20(15(3)36)34-21(37)16(28)8-6-12-31-26(29)30/h14-20,36H,4-13,27-28H2,1-3H3,(H,32,39)(H,33,38)(H,34,37)(H,41,42)(H4,29,30,31)/t15-,16+,17+,18+,19+,20+/m1/s1 InChIKey=HFDHSWWSMCVFFJ-HLXURNFRSA-N |
| Database reference: |