BIOPEP-UWM: Report
| ID | 3615 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | is |
| Activity : | immunostimulating |
|||
| Chemical mass | 642.7494 | Monoisotopic mass | 642.3915 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C26H50N12O7/c1-12(2)18(37-22(42)16(11-17(28)39)36-20(40)14(27)7-5-9-33-25(29)30)23(43)35-15(8-6-10-34-26(31)32)21(41)38-19(13(3)4)24(44)45/h12-16,18-19H,5-11,27H2,1-4H3,(H2,28,39)(H,35,43)(H,36,40)(H,37,42)(H,38,41)(H,44,45)(H4,29,30,33)(H4,31,32,34)/t14-,15-,16-,18-,19-/m0/s1 InChIKey=AKBBLLAAIRUHNW-QAGGRKNESA-N |
| Database reference: |