BIOPEP-UWM: Report
| ID | 3618 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 585.7345 | Monoisotopic mass | 585.3838 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(N)CCCCN)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@]([H])(C(O)=O)[C@@]([H])(C)CC InChI=1S/C27H51N7O7/c1-4-16(2)21(27(40)41)32-24(37)19(11-6-8-14-29)31-25(38)20-12-9-15-34(20)26(39)22(17(3)35)33-23(36)18(30)10-5-7-13-28/h16-22,35H,4-15,28-30H2,1-3H3,(H,31,38)(H,32,37)(H,33,36)(H,40,41)/t16-,17+,18-,19-,20-,21-,22-/m0/s1 InChIKey=WEVSQPNNYCTIEJ-YRCTWBNTSA-N |
| Database reference: |