BIOPEP-UWM: Report
| ID | 3621 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 527.6589 | Monoisotopic mass | 527.3534 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C23H45N9O5/c24-11-3-1-8-16(30-19(33)15(26)7-5-13-29-23(27)28)21(35)32-14-6-10-18(32)20(34)31-17(22(36)37)9-2-4-12-25/h15-18H,1-14,24-26H2,(H,30,33)(H,31,34)(H,36,37)(H4,27,28,29)/t15-,16-,17-,18-/m0/s1 InChIKey=JEZLEGANPXOCIU-XSLAGTTESA-N |
| Database reference: |