BIOPEP-UWM: Report
| ID | 3622 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 472.5773 | Monoisotopic mass | 472.3000 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(N)CCCCN)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C21H40N6O6/c1-13(28)17(26-18(29)14(24)7-2-4-10-22)20(31)27-12-6-9-16(27)19(30)25-15(21(32)33)8-3-5-11-23/h13-17,28H,2-12,22-24H2,1H3,(H,25,30)(H,26,29)(H,32,33)/t13-,14+,15+,16+,17+/m1/s1 InChIKey=IUKYLOAVGWFICM-XAJHFOFHSA-N |
| Database reference: |