BIOPEP-UWM: Report
| ID | 3623 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 457.5627 | Monoisotopic mass | 457.2891 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Słoń J., Kluczyk A., Zbozień R., Stafanowicz P., Siemion I. Z. | |
| Title | |
| The immunomodulatory diversity of the proteins of the transforming growth factor b(TGFb)family. Int.J.Peptide Protein Res.46,113-118(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(N)C(=O)N[C@@]([H])(CCCCN)C(=O)N1CCC[C@@]1([H])C(=O)N[C@]([H])(C(O)=O)[C@@]([H])(C)CC InChI=1S/C21H39N5O6/c1-4-12(2)17(21(31)32)25-18(28)15-9-7-11-26(15)20(30)14(8-5-6-10-22)24-19(29)16(23)13(3)27/h12-17,27H,4-11,22-23H2,1-3H3,(H,24,29)(H,25,28)(H,31,32)/t12-,13+,14-,15-,16-,17-/m0/s1 InChIKey=SIPATOFBFKBSIW-FQMQPWHVSA-N |
| Database reference: |