BIOPEP-UWM: Report
| ID | 3626 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 399.4871 | Monoisotopic mass | 399.2587 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Zimecki M., Słoń J. J., Siemion I. Z. | |
| Title | |
| The immunomodulatory activity of tetra-and tripeptides of tuftsin-kentsin group. Peptides,15(2), 215-221 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C17H33N7O4/c18-8-2-1-5-11(19)14(25)23-12(6-3-9-22-17(20)21)15(26)24-10-4-7-13(24)16(27)28/h11-13H,1-10,18-19H2,(H,23,25)(H,27,28)(H4,20,21,22)/t11-,12-,13-/m0/s1 InChIKey=FUKDBQGFSJUXGX-AVGNSLFASA-N |
| Database reference: |