BIOPEP-UWM: Report
| ID | 3631 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 729.8200 | Monoisotopic mass | 729.3475 | |
| EC50 : | 0.04 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dooley C.T., Kaplan R.A., Chung N.N., Schiller P.W., Bidlack J.M., Houghten R.A. | |
| Title | |
| Six highly active mu-selective opioid peptides identified from two synthetic combinatorial libraries. Peptide Research, 8, 3, 124-137(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(Cc1ccccc1)NC(=O)CNC(=O)[C@]([H])(Cc1ccccc1)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)Cc1ccc(O)cc1)C(N)=O InChI=1S/C38H47N7O8/c1-23(46)33(34(40)49)44-36(51)30(21-25-11-6-3-7-12-25)42-32(48)22-41-35(50)29(20-24-9-4-2-5-10-24)43-37(52)31-13-8-18-45(31)38(53)28(39)19-26-14-16-27(47)17-15-26/h2-7,9-12,14-17,23,28-31,33,46-47H,8,13,18-22,39H2,1H3,(H2,40,49)(H,41,50)(H,42,48)(H,43,52)(H,44,51)/t23-,28+,29+,30+,31+,33+/m1/s1 InChIKey=IKWDDJJJHOMDPS-OWBLVTTQSA-N Originally EC50 was expressed in [nM], in BIOPEP-UWM EC50 value was transformed to [uM]. |
| Database reference: |