BIOPEP-UWM: Report
| ID | 3651 |
| Name | Angiogenesis stimulating peptide |
| sequence |
| Function: | |||
| component of the alpha-chain of laminin, that was confirmed as angiogenesis stimulating factor in vivo | |||
| Number of residues | 6 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 615.7604 | Monoisotopic mass | 615.3943 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kibbey M. C., Corcoran M. L., Wahl L. M., Kleinman H. K. | |
| Title | |
| Laminin SIKVAV peptide-induced angiogenesis in vivo is potentiated by neutrophils. J. Cell. Physiol., 160, 185–193, 1994 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C28H53N7O8/c1-8-16(6)22(35-24(38)18(30)13-36)27(41)32-19(11-9-10-12-29)25(39)33-20(14(2)3)26(40)31-17(7)23(37)34-21(15(4)5)28(42)43/h14-22,36H,8-13,29-30H2,1-7H3,(H,31,40)(H,32,41)(H,33,39)(H,34,37)(H,35,38)(H,42,43)/t16-,17-,18-,19-,20-,21-,22-/m0/s1 InChIKey=OFGVZFQUFJYSGS-CPDXTSBQSA-N Immunomodulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3060) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3060 ChemIDplus: ID 146439-94-3 ChemSpider: ID 8321182 FDA UNII - NLM: ID W9RS1K7T9I J-GLOBAL: ID 200907089089255032 Nikkaji: ID J524.614H PepBank: Peptide SIKVAV PubChem: CID 10145673 |