BIOPEP-UWM: Report
| ID | 3652 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1138.4079 | Monoisotopic mass | 1137.7228 | |
| EC50 : | 440.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C53H91N19O9/c54-22-8-3-15-36(59)45(73)66-38(17-4-9-23-55)49(77)71-43(28-33-30-64-37-16-2-1-14-35(33)37)50(78)72-44(29-34-31-62-32-65-34)51(79)69-39(18-5-10-24-56)46(74)68-41(21-13-27-63-53(60)61)47(75)67-40(19-6-11-25-57)48(76)70-42(52(80)81)20-7-12-26-58/h1-2,14,16,30-32,36,38-44,64H,3-13,15,17-29,54-59H2,(H,62,65)(H,66,73)(H,67,75)(H,68,74)(H,69,79)(H,70,76)(H,71,77)(H,72,78)(H,80,81)(H4,60,61,63)/t36-,38-,39-,40-,41-,42-,43-,44-/m0/s1 InChIKey=VNGKTVVGUYWLAP-IMJZZGAESA-N |
| Database reference: |