BIOPEP-UWM: Report
| ID | 3663 |
| Name |
| sequence |
| Function: | |||
| fragment of beta 1integrin , the C-terminal part of beta1 integrin would be the cysteine proteinase binding site. Cysteine proteinases of papain superfamily is associated with many human cancers. | |||
| Number of residues | 8 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 1045.2038 | Monoisotopic mass | 1044.4820 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dalet-Fumeron V., Boudjennah L., Pagano M. | |
| Title | |
| Binding of the cysteine proteinases papain and cathepsin B-like to coated laminin:Use od synthetic peptides from laminin and from the laminin binding...Arch. Biochem.Biophys., 2(15),283-290(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C49H72N8O15S/c1-25(2)18-34(52-42(64)32(50)23-40(60)61)45(67)54-37(22-29-10-14-31(59)15-11-29)47(69)55-36(21-28-8-12-30(58)13-9-28)46(68)53-35(19-26(3)4)44(66)51-33(16-17-73-7)43(65)56-38(24-41(62)63)48(70)57-39(49(71)72)20-27(5)6/h8-15,25-27,32-39,58-59H,16-24,50H2,1-7H3,(H,51,66)(H,52,64)(H,53,68)(H,54,67)(H,55,69)(H,56,65)(H,57,70)(H,60,61)(H,62,63)(H,71,72)/t32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey=NSIKONOIBPLGKP-FDISYFBBSA-N |
| Database reference: |