BIOPEP-UWM: Report
| ID | 3664 |
| Name |
| sequence |
| Function: | |||
| peptide that is able to displace papain and cathepsin b-like proteinase from coated laminin. | |||
| Number of residues | 10 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 1184.3820 | Monoisotopic mass | 1183.6903 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dalet-Fumeron V., Boudjennah L., Pagano M. | |
| Title | |
| Binding of the cysteine proteinases papain and cathepsin B-like to coated laminin:Use od synthetic peptides from laminin and from the laminin binding...Arch. Biochem.Biophys., 2(15),283-290(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@]([H])(C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@]([H])(C(O)=O)[C@@]([H])(C)CC)[C@@]([H])(C)CC)[C@@]([H])(C)CC)[C@@]([H])(C)CC InChI=1S/C52H93N15O16/c1-10-25(5)38(65-46(77)33(23-35(55)68)62-43(74)30(54)17-16-22-58-52(56)57)48(79)59-29(9)42(73)60-32(19-20-36(69)70)45(76)64-40(27(7)12-3)50(81)66-39(26(6)11-2)49(80)61-31(18-14-15-21-53)44(75)63-34(24-37(71)72)47(78)67-41(51(82)83)28(8)13-4/h25-34,38-41H,10-24,53-54H2,1-9H3,(H2,55,68)(H,59,79)(H,60,73)(H,61,80)(H,62,74)(H,63,75)(H,64,76)(H,65,77)(H,66,81)(H,67,78)(H,69,70)(H,71,72)(H,82,83)(H4,56,57,58)/t25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,38-,39-,40-,41-/m0/s1 InChIKey=BLHKMHHYUVMXTC-YVRCIVIWSA-N |
| Database reference: |