BIOPEP-UWM: Report
| ID | 3667 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 7 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 956.1855 | Monoisotopic mass | 955.6063 | |
| EC50 : | 150.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C45H77N15O8/c1-28(2)23-35(41(64)56-33(18-12-22-53-45(50)51)39(62)57-34(44(67)68)17-8-11-21-48)58-43(66)37(25-30-26-52-27-54-30)60-42(65)36(24-29-13-4-3-5-14-29)59-40(63)32(16-7-10-20-47)55-38(61)31(49)15-6-9-19-46/h3-5,13-14,26-28,31-37H,6-12,15-25,46-49H2,1-2H3,(H,52,54)(H,55,61)(H,56,64)(H,57,62)(H,58,66)(H,59,63)(H,60,65)(H,67,68)(H4,50,51,53)/t31-,32-,33-,34-,35-,36-,37-/m0/s1 InChIKey=AWCQRTHTLXPPAA-PEAOEFARSA-N |
| Database reference: |