BIOPEP-UWM: Report
| ID | 3668 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 7 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 934.1337 | Monoisotopic mass | 933.5743 | |
| EC50 : | 820.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C43H75N13O10/c1-26(2)23-32(39(62)52-30(18-12-22-50-43(48)49)37(60)53-31(42(65)66)17-8-11-21-46)54-41(64)34(25-35(57)58)56-40(63)33(24-27-13-4-3-5-14-27)55-38(61)29(16-7-10-20-45)51-36(59)28(47)15-6-9-19-44/h3-5,13-14,26,28-34H,6-12,15-25,44-47H2,1-2H3,(H,51,59)(H,52,62)(H,53,60)(H,54,64)(H,55,61)(H,56,63)(H,57,58)(H,65,66)(H4,48,49,50)/t28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey=AKDAZLIFNQPTRC-NXBWRCJVSA-N |
| Database reference: |