BIOPEP-UWM: Report
| ID | 3684 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1112.3707 | Monoisotopic mass | 1111.7072 | |
| EC50 : | 160.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O)[C@@]([H])(C)CC InChI=1S/C51H89N19O9/c1-3-31(2)41(48(77)66-37(20-13-25-61-50(56)57)43(72)65-36(19-9-12-24-54)44(73)67-38(49(78)79)21-14-26-62-51(58)59)70-47(76)40(28-33-29-60-30-63-33)69-46(75)39(27-32-15-5-4-6-16-32)68-45(74)35(18-8-11-23-53)64-42(71)34(55)17-7-10-22-52/h4-6,15-16,29-31,34-41H,3,7-14,17-28,52-55H2,1-2H3,(H,60,63)(H,64,71)(H,65,72)(H,66,77)(H,67,73)(H,68,74)(H,69,75)(H,70,76)(H,78,79)(H4,56,57,61)(H4,58,59,62)/t31-,34-,35-,36-,37-,38-,39-,40-,41-/m0/s1 InChIKey=ZTSFMUPDVULXOZ-CEGBIFDESA-N |
| Database reference: |