BIOPEP-UWM: Report
| ID | 3692 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 586.6764 | Monoisotopic mass | 586.3315 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Siemion I. Z., Kluczyk A., Wieczorek Z. | |
| Title | |
| Anti-IL-1 activity of peptide fragments of IL-1 family proteins. Peptides 19, 2, 373-382 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(NC(=O)[C@@]([H])(N)CCC(O)=O)[C@@]([H])(C)CC)C(O)=O InChI=1S/C26H46N6O9/c1-4-14(2)20(30-22(36)16(28)10-11-19(34)35)25(39)32-13-7-9-18(32)24(38)29-17(8-5-6-12-27)23(37)31-21(15(3)33)26(40)41/h14-18,20-21,33H,4-13,27-28H2,1-3H3,(H,29,38)(H,30,36)(H,31,37)(H,34,35)(H,40,41)/t14-,15+,16-,17-,18-,20-,21-/m0/s1 InChIKey=HKDFJPOKVNZPIX-XVYLQWLCSA-N |
| Database reference: |