BIOPEP-UWM: Report
| ID | 3696 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1166.4213 | Monoisotopic mass | 1165.7290 | |
| EC50 : | 300.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C53H91N21O9/c54-21-7-3-14-35(58)44(75)68-37(16-4-8-22-55)48(79)73-42(27-32-29-66-36-15-2-1-13-34(32)36)49(80)74-43(28-33-30-63-31-67-33)50(81)71-40(20-12-26-65-53(61)62)46(77)70-39(19-11-25-64-52(59)60)45(76)69-38(17-5-9-23-56)47(78)72-41(51(82)83)18-6-10-24-57/h1-2,13,15,29-31,35,37-43,66H,3-12,14,16-28,54-58H2,(H,63,67)(H,68,75)(H,69,76)(H,70,77)(H,71,81)(H,72,78)(H,73,79)(H,74,80)(H,82,83)(H4,59,60,64)(H4,61,62,65)/t35-,37-,38-,39-,40-,41-,42-,43-/m0/s1 InChIKey=UXNLRLHJUWAVNS-LVHVEONVSA-N |
| Database reference: |