BIOPEP-UWM: Report
| ID | 3699 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 787.8625 | Monoisotopic mass | 787.4288 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Kluczyk A., Słoń-Usakiewicz J. J., Siemion I. Z. | |
| Title | |
| A hexapeptide VTKFYF from C-terminal part of interleukin-1 receptor antagonis, an inhibitor of IL-1 - IL-1 receptor interaction. Pol. J. Pharmacol., 49, 107-117 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C31H57N13O11/c32-11-3-1-6-17(41-27(51)18(8-5-13-39-31(37)38)40-25(49)16(34)14-23(36)46)26(50)42-19(9-10-22(35)45)28(52)44-21(15-24(47)48)29(53)43-20(30(54)55)7-2-4-12-33/h16-21H,1-15,32-34H2,(H2,35,45)(H2,36,46)(H,40,49)(H,41,51)(H,42,50)(H,43,53)(H,44,52)(H,47,48)(H,54,55)(H4,37,38,39)/t16-,17-,18-,19-,20-,21-/m0/s1 InChIKey=PBDZKADCTMZCRM-PXQJOHHUSA-N |
| Database reference: |