BIOPEP-UWM: Report
| ID | 3700 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 829.9453 | Monoisotopic mass | 829.4869 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Kluczyk A., Słoń-Usakiewicz J. J., Siemion I. Z. | |
| Title | |
| A hexapeptide VTKFYF from C-terminal part of interleukin-1 receptor antagonis, an inhibitor of IL-1 - IL-1 receptor interaction. | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C33H63N15O10/c34-13-3-1-8-19(44-26(52)18(36)7-5-15-42-32(38)39)27(53)46-21(11-12-24(37)49)29(55)48-23(17-25(50)51)30(56)45-20(9-2-4-14-35)28(54)47-22(31(57)58)10-6-16-43-33(40)41/h18-23H,1-17,34-36H2,(H2,37,49)(H,44,52)(H,45,56)(H,46,53)(H,47,54)(H,48,55)(H,50,51)(H,57,58)(H4,38,39,42)(H4,40,41,43)/t18-,19-,20-,21-,22-,23-/m0/s1 InChIKey=KSBSAAHLBGQJPG-LLINQDLYSA-N |
| Database reference: |