BIOPEP-UWM: Report
| ID | 3701 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 9 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 1220.3349 | Monoisotopic mass | 1219.6403 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Kluczyk A., Słoń-Usakiewicz J. J., Siemion I. Z. | |
| Title | |
| A hexapeptide VTKFYF from C-terminal part of interleukin-1 receptor antagonis, an inhibitor of IL-1 - IL-1 receptor interaction. Pol. J. Pharmacol., 49, 107-117 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C51H85N19O16/c52-20-6-4-12-29(63-44(80)31(14-8-22-61-50(57)58)66-47(83)34(25-38(56)72)68-41(77)28(54)16-19-39(73)74)43(79)67-33(17-18-37(55)71)46(82)69-35(26-40(75)76)48(84)65-30(13-5-7-21-53)42(78)64-32(15-9-23-62-51(59)60)45(81)70-36(49(85)86)24-27-10-2-1-3-11-27/h1-3,10-11,28-36H,4-9,12-26,52-54H2,(H2,55,71)(H2,56,72)(H,63,80)(H,64,78)(H,65,84)(H,66,83)(H,67,79)(H,68,77)(H,69,82)(H,70,81)(H,73,74)(H,75,76)(H,85,86)(H4,57,58,61)(H4,59,60,62)/t28-,29-,30-,31-,32-,33-,34-,35-,36-/m0/s1 InChIKey=VWDWJUJDNLYLKP-VXJRNSOOSA-N |
| Database reference: |