BIOPEP-UWM: Report
| ID | 3702 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 656.7677 | Monoisotopic mass | 656.3522 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Kluczyk A., Słoń-Usakiewicz J. J., Siemion I. Z. | |
| Title | |
| A hexapeptide VTKFYF from C-terminal part of interleukin-1 receptor antagonis, an inhibitor of IL-1 - IL-1 receptor interaction. Pol. J. Pharmacol., 49, 107-117 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@@]([H])(N)C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C33H48N6O8/c1-19(2)27(35)31(44)39-28(20(3)40)32(45)36-24(11-7-8-16-34)29(42)37-25(17-21-9-5-4-6-10-21)30(43)38-26(33(46)47)18-22-12-14-23(41)15-13-22/h4-6,9-10,12-15,19-20,24-28,40-41H,7-8,11,16-18,34-35H2,1-3H3,(H,36,45)(H,37,42)(H,38,43)(H,39,44)(H,46,47)/t20-,24+,25+,26+,27+,28+/m1/s1 InChIKey=PUSHUKVBBBVSFF-JENZNMKPSA-N |
| Database reference: |