BIOPEP-UWM: Report
| ID | 3718 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 9 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 962.0613 | Monoisotopic mass | 961.5079 | |
| EC50 : | 2600.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mukhija S., Germeroth L., Schneider-Mergener J., Erni B. | |
| Title | |
| Identification of peptides inhibiting enzyme I of the bacterial phosphotransferase system using combinatorial cellulose-bound peptide libraries.Eur. J. Biochem.254, 433-438(1998) | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@]([H])(CC(C)C)NC(=O)CNC(=O)[C@]([H])(CC(N)=O)NC(=O)[C@]1([H])CCCN1)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C41H67N15O12/c1-20(2)14-26(51-31(59)18-48-33(60)28(16-30(42)58)54-34(61)24-8-5-11-46-24)35(62)53-27(15-23-17-45-19-49-23)36(63)55-32(22(4)57)38(65)52-25(9-6-12-47-41(43)44)39(66)56-13-7-10-29(56)37(64)50-21(3)40(67)68/h17,19-22,24-29,32,46,57H,5-16,18H2,1-4H3,(H2,42,58)(H,45,49)(H,48,60)(H,50,64)(H,51,59)(H,52,65)(H,53,62)(H,54,61)(H,55,63)(H,67,68)(H4,43,44,47)/t21-,22+,24-,25-,26-,27-,28-,29-,32-/m0/s1 InChIKey=CMEQGZPDJCOXKE-YSXLRMDJSA-N |
| Database reference: |