BIOPEP-UWM: Report
| ID | 3735 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 673.7601 | Monoisotopic mass | 673.3860 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Kluczyk A., Słoń-Usakiewicz J. J., Siemion I. Z. | |
| Title | |
| A hexapeptide VTKFYF from C-terminal part of interleukin-1 receptor antagonis, an inhibitor of IL-1 - IL-1 receptor interaction. Pol. J. Pharmacol., 49, 107-117 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C27H51N11O9/c28-11-3-1-7-16(35-22(42)15(30)6-5-13-34-27(32)33)23(43)36-17(9-10-20(31)39)24(44)38-19(14-21(40)41)25(45)37-18(26(46)47)8-2-4-12-29/h15-19H,1-14,28-30H2,(H2,31,39)(H,35,42)(H,36,43)(H,37,45)(H,38,44)(H,40,41)(H,46,47)(H4,32,33,34)/t15-,16-,17-,18-,19-/m0/s1 InChIKey=SGMMIKWMNGBNJC-VMXHOPILSA-N |
| Database reference: |