BIOPEP-UWM: Report
| ID | 3739 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 500.5907 | Monoisotopic mass | 500.3062 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Zimecki M., Słoń J. J., Siemion I. Z. | |
| Title | |
| The immunomodulatory activity of tetra-and tripeptides of tuftsin-kentsin group. Peptides,15(2), 215-221 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)17(31)28-14(7-4-10-26-21(24)25)19(33)29-11-5-8-15(29)20(34)35/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13+,14+,15+,16+/m1/s1 InChIKey=OKKCFSNQOOPRTF-YXMSTPNBSA-N |
| Database reference: |