BIOPEP-UWM: Report
| ID | 3744 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | che |
| Activity : | chemotactic |
|||
| Chemical mass | 399.4409 | Monoisotopic mass | 399.2111 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Castiglione Morelli M. A., Bisaccia F., Spisani S., De Biasi M., Traniello S. T. | |
| Title | |
| Structure-activity relationships for some elastin derived peptide chemoattractants. J.Peptide Res.,49,492-499(1997) | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)CNC(=O)[C@@]([H])(N)C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)NCC(O)=O InChI=1S/C17H29N5O6/c1-9(2)14(18)16(27)19-7-12(23)21-10(3)17(28)22-6-4-5-11(22)15(26)20-8-13(24)25/h9-11,14H,4-8,18H2,1-3H3,(H,19,27)(H,20,26)(H,21,23)(H,24,25)/t10-,11-,14-/m0/s1 InChIKey=KGRJWMZFVYOGDR-MJVIPROJSA-N |
| Database reference: |