BIOPEP-UWM: Report
| ID | 3749 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 330.3790 | Monoisotopic mass | 330.1897 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Caliendo G., Greco G., Grieco P., Perissutti E., Santagada V., Ialenti A., Maffi | |
| Title | |
| Synthesis and antinociceptive activity of peptides related to interleukin-1b193-195 Lys-Pro-Thr. John Wiley&Sons,479-483(1997) | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C14H26N4O5/c15-6-2-1-4-9(16)13(21)18-7-3-5-11(18)12(20)17-10(8-19)14(22)23/h9-11,19H,1-8,15-16H2,(H,17,20)(H,22,23)/t9-,10-,11-/m0/s1 InChIKey=YTJFXEDRUOQGSP-DCAQKATOSA-N |
| Database reference: |