BIOPEP-UWM: Report
| ID | 3752 |
| Name | Bacterial permease ligand |
| sequence |
| Function: | |||
| Bacterial permease ligand | |||
| Number of residues | 3 |
Activity code | lig |
| Activity : | bacterial permease ligand |
|||
| Chemical mass | 402.5306 | Monoisotopic mass | 402.2946 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sleigh S. H., Tame J. R. H., Dodson E. J., Wilkinson A. J. | |
| Title | |
| Peptide binding in OppA, the crystal structure of the periplasmic oligopeptide binding protein in the unliganded form and in complex with lisyllysine. Biochemistry, 36, 9747-9758, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C18H38N6O4/c19-10-4-1-7-13(22)16(25)23-14(8-2-5-11-20)17(26)24-15(18(27)28)9-3-6-12-21/h13-15H,1-12,19-22H2,(H,23,25)(H,24,26)(H,27,28)/t13-,14-,15-/m0/s1 InChIKey=WBSCNDJQPKSPII-KKUMJFAQSA-N |
| Database reference: |
| ACToR: ID 25988-63-0 BRENDA: Ligand Lys-Lys-Lys CAS: Registry No 25988-63-0 ChEBI: ID CHEBI:160118 ChEMBL: ID CHEMBL1229077 ChemSpider: ID 65300 EPA CompTox: ID DTXSID40948891 J-GLOBAL: ID 200907062475057037 Metabolomics Workbench: ID 83687 Nikkaji: ID J535.915E PubChem: CID 72363 UNII: ID Y7F82M80K8 SureChEMBL: ID SCHEMBL3796535 UniChem: ID 638812 Wikidata: ID Q27294355 ZINC: ID ZINC000004556777 |