BIOPEP-UWM: Report
| ID | 3753 |
| Name | Bacterial permease ligand |
| sequence |
| Function: | |||
| Bacterial permease ligand | |||
| Number of residues | 4 |
Activity code | lig |
| Activity : | bacterial permease ligand |
|||
| Chemical mass | 473.6083 | Monoisotopic mass | 473.3316 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sleigh S. H., Tame J. R. H., Dodson E. J., Wilkinson A. J. | |
| Title | |
| Peptide binding in OppA, the crystal structure of the periplasmic oligopeptide binding protein in the unliganded form and in complex with lisyllysine. Biochemistry, 36, 9747-9758, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C21H43N7O5/c1-14(21(32)33)26-19(30)16(9-3-6-12-23)28-20(31)17(10-4-7-13-24)27-18(29)15(25)8-2-5-11-22/h14-17H,2-13,22-25H2,1H3,(H,26,30)(H,27,29)(H,28,31)(H,32,33)/t14-,15-,16-,17-/m0/s1 InChIKey=XMHFAWNHFNHUTI-QAETUUGQSA-N |
| Database reference: |