BIOPEP-UWM: Report
| ID | 3760 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 344.4055 | Monoisotopic mass | 344.2053 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Caliendo G., Greco G., Grieco P., Perissutti E., Santagada V., Ialenti A., Maffi | |
| Title | |
| Synthesis and antinociceptive activity of peptides related to interleukin-1b193-195 Lys-Pro-Thr. John Wiley&Sons,479-483(1997) | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)CCCCN)C(O)=O InChI=1S/C15H28N4O5/c1-9(20)12(15(23)24)18-13(21)11-6-4-8-19(11)14(22)10(17)5-2-3-7-16/h9-12,20H,2-8,16-17H2,1H3,(H,18,21)(H,23,24)/t9-,10+,11+,12+/m1/s1 InChIKey=LOGFVTREOLYCPF-RHYQMDGZSA-N |
| Database reference: |